C12H12Cl2 — CID 12881547
1-chloro-4-[(1Z)-1-chloro-4-methylpenta-1,3-dienyl]benzene (PubChem CID 12881547) has the molecular formula C12H12Cl2 and a molecular weight of 227.13 g/mol. Its IUPAC name is 1-chloro-4-[(1Z)-1-chloro-4-methylpenta-1,3-dienyl]benzene.
| Compound Name | 1-chloro-4-[(1Z)-1-chloro-4-methylpenta-1,3-dienyl]benzene |
|---|---|
| PubChem CID | 12881547 |
| Molecular Formula | C12H12Cl2 |
| Molecular Weight | 227.13 g/mol |
| Exact Mass | 226.03 |
| IUPAC Name | 1-chloro-4-[(1Z)-1-chloro-4-methylpenta-1,3-dienyl]benzene |
| SMILES | CC(C)=C/C=C(\Cl)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H12Cl2/c1-9(2)3-8-12(14)10-4-6-11(13)7-5-10/h3-8H,1-2H3/b12-8- |
| InChIKey | ZKLKEWYWNHPRPF-WQLSENKSSA-N |
| XLogP | 4.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.13 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|