About [(Z)-3-chloro-3-(4-chlorophenyl)prop-2-enylidene]-dimethylazanium;dichlorophosphinate
[(Z)-3-chloro-3-(4-chlorophenyl)prop-2-enylidene]-dimethylazanium;dichlorophosphinate (PubChem CID 6446895) has the molecular formula C11H12Cl4NO2P
and a molecular weight of 363.01 g/mol. Its IUPAC name is [(Z)-3-chloro-3-(4-chlorophenyl)prop-2-enylidene]-dimethylazanium;dichlorophosphinate.
Molecular Properties
| Compound Name | [(Z)-3-chloro-3-(4-chlorophenyl)prop-2-enylidene]-dimethylazanium;dichlorophosphinate |
| PubChem CID | 6446895 |
| Molecular Formula | C11H12Cl4NO2P |
| Molecular Weight | 363.01 g/mol |
| Exact Mass | 360.94 |
| IUPAC Name | [(Z)-3-chloro-3-(4-chlorophenyl)prop-2-enylidene]-dimethylazanium;dichlorophosphinate |
| SMILES | C[N+](C)=C/C=C(\Cl)c1ccc(Cl)cc1.O=P([O-])(Cl)Cl |
| InChI | InChI=1S/C11H12Cl2N.Cl2HO2P/c1-14(2)8-7-11(13)9-3-5-10(12)6-4-9;1-5(2,3)4/h3-8H,1-2H3;(H,3,4)/q+1;/p-1/b11-7-; |
| InChIKey | OLENMILJACHWSO-AJULUCINSA-M |
| XLogP | 4.20 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.01 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-3-chloro-3-(4-chlorophenyl)prop-2-enylidene]-dimethylazanium;dichlorophosphinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-3-chloro-3-(4-chlorophenyl)prop-2-enylidene]-dimethylazanium;dichlorophosphinate?
The IUPAC name of [(Z)-3-chloro-3-(4-chlorophenyl)prop-2-enylidene]-dimethylazanium;dichlorophosphinate (CID 6446895) is [(Z)-3-chloro-3-(4-chlorophenyl)prop-2-enylidene]-dimethylazanium;dichlorophosphinate.
What is the SMILES notation for [(Z)-3-chloro-3-(4-chlorophenyl)prop-2-enylidene]-dimethylazanium;dichlorophosphinate?
The canonical SMILES for [(Z)-3-chloro-3-(4-chlorophenyl)prop-2-enylidene]-dimethylazanium;dichlorophosphinate is C[N+](C)=C/C=C(\Cl)c1ccc(Cl)cc1.O=P([O-])(Cl)Cl.
What is the InChIKey of [(Z)-3-chloro-3-(4-chlorophenyl)prop-2-enylidene]-dimethylazanium;dichlorophosphinate?
The InChIKey is OLENMILJACHWSO-AJULUCINSA-M. The full InChI is InChI=1S/C11H12Cl2N.Cl2HO2P/c1-14(2)8-7-11(13)9-3-5-10(12)6-4-9;1-5(2,3)4/h3-8H,1-2H3;(H,3,4)/q+1;/p-1/b11-7-;.
What are the key properties of [(Z)-3-chloro-3-(4-chlorophenyl)prop-2-enylidene]-dimethylazanium;dichlorophosphinate?
[(Z)-3-chloro-3-(4-chlorophenyl)prop-2-enylidene]-dimethylazanium;dichlorophosphinate has a molecular weight of 363.01 g/mol, XLogP of 4.20, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-3-chloro-3-(4-chlorophenyl)prop-2-enylidene]-dimethylazanium;dichlorophosphinate is sourced from PubChem (CID 6446895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).