C11H13Cl2O4P — CID 7018978
(Z,1S)-3-chloro-3-(4-chlorophenyl)-1-dimethoxyphosphorylprop-2-en-1-ol (PubChem CID 7018978) has the molecular formula C11H13Cl2O4P and a molecular weight of 311.10 g/mol. Its IUPAC name is (Z,1S)-3-chloro-3-(4-chlorophenyl)-1-dimethoxyphosphorylprop-2-en-1-ol.
| Compound Name | (Z,1S)-3-chloro-3-(4-chlorophenyl)-1-dimethoxyphosphorylprop-2-en-1-ol |
|---|---|
| PubChem CID | 7018978 |
| Molecular Formula | C11H13Cl2O4P |
| Molecular Weight | 311.10 g/mol |
| Exact Mass | 309.99 |
| IUPAC Name | (Z,1S)-3-chloro-3-(4-chlorophenyl)-1-dimethoxyphosphorylprop-2-en-1-ol |
| SMILES | COP(=O)(OC)[C@H](O)/C=C(\Cl)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H13Cl2O4P/c1-16-18(15,17-2)11(14)7-10(13)8-3-5-9(12)6-4-8/h3-7,11,14H,1-2H3/b10-7-/t11-/m0/s1 |
| InChIKey | CNONALSSANSMRX-BRNRAETOSA-N |
| XLogP | 3.72 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.10 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|