C13H19ClNO3P — CID 2780835
3-chloro-1-dimethoxyphosphoryl-N,N-dimethyl-3-phenylprop-2-en-1-amine (PubChem CID 2780835) has the molecular formula C13H19ClNO3P and a molecular weight of 303.73 g/mol. Its IUPAC name is 3-chloro-1-dimethoxyphosphoryl-N,N-dimethyl-3-phenylprop-2-en-1-amine.
| Compound Name | 3-chloro-1-dimethoxyphosphoryl-N,N-dimethyl-3-phenylprop-2-en-1-amine |
|---|---|
| PubChem CID | 2780835 |
| Molecular Formula | C13H19ClNO3P |
| Molecular Weight | 303.73 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 3-chloro-1-dimethoxyphosphoryl-N,N-dimethyl-3-phenylprop-2-en-1-amine |
| SMILES | COP(=O)(OC)C(C=C(Cl)c1ccccc1)N(C)C |
| InChI | InChI=1S/C13H19ClNO3P/c1-15(2)13(19(16,17-3)18-4)10-12(14)11-8-6-5-7-9-11/h5-10,13H,1-4H3 |
| InChIKey | BYTZWWDLTWSOGT-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.73 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|