C15H23ClNO3P — CID 40511910
(Z,1R)-3-chloro-1-diethoxyphosphoryl-N,N-dimethyl-3-phenylprop-2-en-1-amine (PubChem CID 40511910) has the molecular formula C15H23ClNO3P and a molecular weight of 331.78 g/mol. Its IUPAC name is (Z,1R)-3-chloro-1-diethoxyphosphoryl-N,N-dimethyl-3-phenylprop-2-en-1-amine.
| Compound Name | (Z,1R)-3-chloro-1-diethoxyphosphoryl-N,N-dimethyl-3-phenylprop-2-en-1-amine |
|---|---|
| PubChem CID | 40511910 |
| Molecular Formula | C15H23ClNO3P |
| Molecular Weight | 331.78 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | (Z,1R)-3-chloro-1-diethoxyphosphoryl-N,N-dimethyl-3-phenylprop-2-en-1-amine |
| SMILES | CCOP(=O)(OCC)[C@H](/C=C(\Cl)c1ccccc1)N(C)C |
| InChI | InChI=1S/C15H23ClNO3P/c1-5-19-21(18,20-6-2)15(17(3)4)12-14(16)13-10-8-7-9-11-13/h7-12,15H,5-6H2,1-4H3/b14-12-/t15-/m1/s1 |
| InChIKey | WJVNYZBAAFGAGF-IKESIWSLSA-N |
| XLogP | 4.42 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.78 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|