C16H26NO4P — CID 11771778
(2R,3S)-3-diethoxyphosphoryl-3-(dimethylamino)-2-methyl-1-phenylpropan-1-one (PubChem CID 11771778) has the molecular formula C16H26NO4P and a molecular weight of 327.36 g/mol. Its IUPAC name is (2R,3S)-3-diethoxyphosphoryl-3-(dimethylamino)-2-methyl-1-phenylpropan-1-one.
| Compound Name | (2R,3S)-3-diethoxyphosphoryl-3-(dimethylamino)-2-methyl-1-phenylpropan-1-one |
|---|---|
| PubChem CID | 11771778 |
| Molecular Formula | C16H26NO4P |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | (2R,3S)-3-diethoxyphosphoryl-3-(dimethylamino)-2-methyl-1-phenylpropan-1-one |
| SMILES | CCOP(=O)(OCC)[C@@H]([C@H](C)C(=O)c1ccccc1)N(C)C |
| InChI | InChI=1S/C16H26NO4P/c1-6-20-22(19,21-7-2)16(17(4)5)13(3)15(18)14-11-9-8-10-12-14/h8-13,16H,6-7H2,1-5H3/t13-,16+/m1/s1 |
| InChIKey | YPVJFKJSNPNUNP-CJNGLKHVSA-N |
| XLogP | 3.66 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|