C15H20Cl2NO5P — CID 2784690
N-(2,2-dichloro-1-diethoxyphosphoryl-3-oxo-3-phenylpropyl)acetamide (PubChem CID 2784690) has the molecular formula C15H20Cl2NO5P and a molecular weight of 396.21 g/mol. Its IUPAC name is N-(2,2-dichloro-1-diethoxyphosphoryl-3-oxo-3-phenylpropyl)acetamide.
| Compound Name | N-(2,2-dichloro-1-diethoxyphosphoryl-3-oxo-3-phenylpropyl)acetamide |
|---|---|
| PubChem CID | 2784690 |
| Molecular Formula | C15H20Cl2NO5P |
| Molecular Weight | 396.21 g/mol |
| Exact Mass | 395.05 |
| IUPAC Name | N-(2,2-dichloro-1-diethoxyphosphoryl-3-oxo-3-phenylpropyl)acetamide |
| SMILES | CCOP(=O)(OCC)C(NC(C)=O)C(Cl)(Cl)C(=O)c1ccccc1 |
| InChI | InChI=1S/C15H20Cl2NO5P/c1-4-22-24(21,23-5-2)14(18-11(3)19)15(16,17)13(20)12-9-7-6-8-10-12/h6-10,14H,4-5H2,1-3H3,(H,18,19) |
| InChIKey | SOJGBBXXUABXAV-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.21 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|