C8H12Cl3F3NO4P — CID 2325317
2,2,2-trifluoro-N-[(1S)-2,2,2-trichloro-1-diethoxyphosphorylethyl]acetamide (PubChem CID 2325317) has the molecular formula C8H12Cl3F3NO4P and a molecular weight of 380.51 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(1S)-2,2,2-trichloro-1-diethoxyphosphorylethyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(1S)-2,2,2-trichloro-1-diethoxyphosphorylethyl]acetamide |
|---|---|
| PubChem CID | 2325317 |
| Molecular Formula | C8H12Cl3F3NO4P |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 378.95 |
| IUPAC Name | 2,2,2-trifluoro-N-[(1S)-2,2,2-trichloro-1-diethoxyphosphorylethyl]acetamide |
| SMILES | CCOP(=O)(OCC)[C@H](NC(=O)C(F)(F)F)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C8H12Cl3F3NO4P/c1-3-18-20(17,19-4-2)6(7(9,10)11)15-5(16)8(12,13)14/h6H,3-4H2,1-2H3,(H,15,16)/t6-/m0/s1 |
| InChIKey | MNRXNBJEJWOIBG-LURJTMIESA-N |
| XLogP | 3.63 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|