C20H26Cl3N2O6P — CID 139088580
(2R)-2-(1,3-dioxoisoindol-2-yl)-4-methyl-N-[(1S)-2,2,2-trichloro-1-diethoxyphosphorylethyl]pentanamide (PubChem CID 139088580) has the molecular formula C20H26Cl3N2O6P and a molecular weight of 527.77 g/mol. Its IUPAC name is (2R)-2-(1,3-dioxoisoindol-2-yl)-4-methyl-N-[(1S)-2,2,2-trichloro-1-diethoxyphosphorylethyl]pentanamide.
| Compound Name | (2R)-2-(1,3-dioxoisoindol-2-yl)-4-methyl-N-[(1S)-2,2,2-trichloro-1-diethoxyphosphorylethyl]pentanamide |
|---|---|
| PubChem CID | 139088580 |
| Molecular Formula | C20H26Cl3N2O6P |
| Molecular Weight | 527.77 g/mol |
| Exact Mass | 526.06 |
| IUPAC Name | (2R)-2-(1,3-dioxoisoindol-2-yl)-4-methyl-N-[(1S)-2,2,2-trichloro-1-diethoxyphosphorylethyl]pentanamide |
| SMILES | CCOP(=O)(OCC)[C@H](NC(=O)[C@@H](CC(C)C)N1C(=O)c2ccccc2C1=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C20H26Cl3N2O6P/c1-5-30-32(29,31-6-2)19(20(21,22)23)24-16(26)15(11-12(3)4)25-17(27)13-9-7-8-10-14(13)18(25)28/h7-10,12,15,19H,5-6,11H2,1-4H3,(H,24,26)/t15-,19+/m1/s1 |
| InChIKey | PWXJGTVIXCVNMC-BEFAXECRSA-N |
| XLogP | 4.78 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.77 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|