C15H20NO6P — CID 14711151
2-[(1R,2S)-1-diethoxyphosphoryl-1-hydroxypropan-2-yl]isoindole-1,3-dione (PubChem CID 14711151) has the molecular formula C15H20NO6P and a molecular weight of 341.30 g/mol. Its IUPAC name is 2-[(1R,2S)-1-diethoxyphosphoryl-1-hydroxypropan-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[(1R,2S)-1-diethoxyphosphoryl-1-hydroxypropan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 14711151 |
| Molecular Formula | C15H20NO6P |
| Molecular Weight | 341.30 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 2-[(1R,2S)-1-diethoxyphosphoryl-1-hydroxypropan-2-yl]isoindole-1,3-dione |
| SMILES | CCOP(=O)(OCC)[C@@H](O)[C@H](C)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C15H20NO6P/c1-4-21-23(20,22-5-2)15(19)10(3)16-13(17)11-8-6-7-9-12(11)14(16)18/h6-10,15,19H,4-5H2,1-3H3/t10-,15+/m0/s1 |
| InChIKey | CFSWNICFXROUSX-ZUZCIYMTSA-N |
| XLogP | 2.26 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.30 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|