C21H38NO4Rh2-4 — CID 135036186
carbanide;2-[(3S)-1,1-dihydroxy-3-methylpentan-2-yl]isoindole-1,3-dione;rhodium;rhodium(3+) (PubChem CID 135036186) has the molecular formula C21H38NO4Rh2-4 and a molecular weight of 574.35 g/mol. Its IUPAC name is carbanide;2-[(3S)-1,1-dihydroxy-3-methylpentan-2-yl]isoindole-1,3-dione;rhodium;rhodium(3+).
| Compound Name | carbanide;2-[(3S)-1,1-dihydroxy-3-methylpentan-2-yl]isoindole-1,3-dione;rhodium;rhodium(3+) |
|---|---|
| PubChem CID | 135036186 |
| Molecular Formula | C21H38NO4Rh2-4 |
| Molecular Weight | 574.35 g/mol |
| Exact Mass | 574.09 |
| IUPAC Name | carbanide;2-[(3S)-1,1-dihydroxy-3-methylpentan-2-yl]isoindole-1,3-dione;rhodium;rhodium(3+) |
| SMILES | CC[C@H](C)C(C(O)O)N1C(=O)c2ccccc2C1=O.[CH3-].[CH3-].[CH3-].[CH3-].[CH3-].[CH3-].[CH3-].[Rh+3].[Rh] |
| InChI | InChI=1S/C14H17NO4.7CH3.2Rh/c1-3-8(2)11(14(18)19)15-12(16)9-6-4-5-7-10(9)13(15)17;;;;;;;;;/h4-8,11,14,18-19H,3H2,1-2H3;7*1H3;;/q;7*-1;;+3/t8-,11?;;;;;;;;;/m0........./s1 |
| InChIKey | JWWZJKMDPYSNBQ-CPYQECOHSA-N |
| XLogP | 4.16 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.35 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|