C21H21FN2O3 — CID 84873550
2-(1,3-dioxoisoindol-2-yl)-N-[(2-fluorophenyl)methyl]-3-methylpentanamide (PubChem CID 84873550) has the molecular formula C21H21FN2O3 and a molecular weight of 368.41 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-[(2-fluorophenyl)methyl]-3-methylpentanamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-[(2-fluorophenyl)methyl]-3-methylpentanamide |
|---|---|
| PubChem CID | 84873550 |
| Molecular Formula | C21H21FN2O3 |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-[(2-fluorophenyl)methyl]-3-methylpentanamide |
| SMILES | CCC(C)C(C(=O)NCc1ccccc1F)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C21H21FN2O3/c1-3-13(2)18(19(25)23-12-14-8-4-7-11-17(14)22)24-20(26)15-9-5-6-10-16(15)21(24)27/h4-11,13,18H,3,12H2,1-2H3,(H,23,25) |
| InChIKey | BMRVGXBXZHZSIY-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|