C21H19F2NO4 — CID 55935128
(2,3-difluorophenyl)methyl (2S,3S)-2-(1,3-dioxoisoindol-2-yl)-3-methylpentanoate (PubChem CID 55935128) has the molecular formula C21H19F2NO4 and a molecular weight of 387.38 g/mol. Its IUPAC name is (2,3-difluorophenyl)methyl (2S,3S)-2-(1,3-dioxoisoindol-2-yl)-3-methylpentanoate.
| Compound Name | (2,3-difluorophenyl)methyl (2S,3S)-2-(1,3-dioxoisoindol-2-yl)-3-methylpentanoate |
|---|---|
| PubChem CID | 55935128 |
| Molecular Formula | C21H19F2NO4 |
| Molecular Weight | 387.38 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | (2,3-difluorophenyl)methyl (2S,3S)-2-(1,3-dioxoisoindol-2-yl)-3-methylpentanoate |
| SMILES | CC[C@H](C)[C@@H](C(=O)OCc1cccc(F)c1F)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C21H19F2NO4/c1-3-12(2)18(21(27)28-11-13-7-6-10-16(22)17(13)23)24-19(25)14-8-4-5-9-15(14)20(24)26/h4-10,12,18H,3,11H2,1-2H3/t12-,18-/m0/s1 |
| InChIKey | ALVIGYYVAXLHGY-SGTLLEGYSA-N |
| XLogP | 3.72 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|