C23H21N3O5 — CID 92544123
(4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl (2S,3S)-2-(1,3-dioxoisoindol-2-yl)-3-methylpentanoate (PubChem CID 92544123) has the molecular formula C23H21N3O5 and a molecular weight of 419.44 g/mol. Its IUPAC name is (4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl (2S,3S)-2-(1,3-dioxoisoindol-2-yl)-3-methylpentanoate.
| Compound Name | (4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl (2S,3S)-2-(1,3-dioxoisoindol-2-yl)-3-methylpentanoate |
|---|---|
| PubChem CID | 92544123 |
| Molecular Formula | C23H21N3O5 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | (4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl (2S,3S)-2-(1,3-dioxoisoindol-2-yl)-3-methylpentanoate |
| SMILES | CC[C@H](C)[C@@H](C(=O)OCc1cc(=O)n2ccccc2n1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C23H21N3O5/c1-3-14(2)20(26-21(28)16-8-4-5-9-17(16)22(26)29)23(30)31-13-15-12-19(27)25-11-7-6-10-18(25)24-15/h4-12,14,20H,3,13H2,1-2H3/t14-,20-/m0/s1 |
| InChIKey | NOHGXIFXGIZXRP-XOBRGWDASA-N |
| XLogP | 2.45 |
| TPSA | 98.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|