C23H16N2O4 — CID 17424407
(4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-benzoylbenzoate (PubChem CID 17424407) has the molecular formula C23H16N2O4 and a molecular weight of 384.39 g/mol. Its IUPAC name is (4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-benzoylbenzoate.
| Compound Name | (4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-benzoylbenzoate |
|---|---|
| PubChem CID | 17424407 |
| Molecular Formula | C23H16N2O4 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | (4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-benzoylbenzoate |
| SMILES | O=C(OCc1cc(=O)n2ccccc2n1)c1ccccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C23H16N2O4/c26-21-14-17(24-20-12-6-7-13-25(20)21)15-29-23(28)19-11-5-4-10-18(19)22(27)16-8-2-1-3-9-16/h1-14H,15H2 |
| InChIKey | DVRMTMAFPHWPTL-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 77.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |