C24H20N2O3 — CID 18203378
(4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-(2-phenylethyl)benzoate (PubChem CID 18203378) has the molecular formula C24H20N2O3 and a molecular weight of 384.44 g/mol. Its IUPAC name is (4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-(2-phenylethyl)benzoate.
| Compound Name | (4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-(2-phenylethyl)benzoate |
|---|---|
| PubChem CID | 18203378 |
| Molecular Formula | C24H20N2O3 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | (4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-(2-phenylethyl)benzoate |
| SMILES | O=C(OCc1cc(=O)n2ccccc2n1)c1ccccc1CCc1ccccc1 |
| InChI | InChI=1S/C24H20N2O3/c27-23-16-20(25-22-12-6-7-15-26(22)23)17-29-24(28)21-11-5-4-10-19(21)14-13-18-8-2-1-3-9-18/h1-12,15-16H,13-14,17H2 |
| InChIKey | SEIQTUMGHKPLMD-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |