C19H16N2O4 — CID 45352057
(4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 4-oxo-4-phenylbutanoate (PubChem CID 45352057) has the molecular formula C19H16N2O4 and a molecular weight of 336.35 g/mol. Its IUPAC name is (4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 4-oxo-4-phenylbutanoate.
| Compound Name | (4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 4-oxo-4-phenylbutanoate |
|---|---|
| PubChem CID | 45352057 |
| Molecular Formula | C19H16N2O4 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | (4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 4-oxo-4-phenylbutanoate |
| SMILES | O=C(CCC(=O)c1ccccc1)OCc1cc(=O)n2ccccc2n1 |
| InChI | InChI=1S/C19H16N2O4/c22-16(14-6-2-1-3-7-14)9-10-19(24)25-13-15-12-18(23)21-11-5-4-8-17(21)20-15/h1-8,11-12H,9-10,13H2 |
| InChIKey | CJCJAIHJBXZJBA-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 77.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |