C24H25FN2O5 — CID 55944497
[2-[(2-fluorophenyl)methyl-methylamino]-2-oxoethyl] (2S,3S)-2-(1,3-dioxoisoindol-2-yl)-3-methylpentanoate (PubChem CID 55944497) has the molecular formula C24H25FN2O5 and a molecular weight of 440.47 g/mol. Its IUPAC name is [2-[(2-fluorophenyl)methyl-methylamino]-2-oxoethyl] (2S,3S)-2-(1,3-dioxoisoindol-2-yl)-3-methylpentanoate.
| Compound Name | [2-[(2-fluorophenyl)methyl-methylamino]-2-oxoethyl] (2S,3S)-2-(1,3-dioxoisoindol-2-yl)-3-methylpentanoate |
|---|---|
| PubChem CID | 55944497 |
| Molecular Formula | C24H25FN2O5 |
| Molecular Weight | 440.47 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | [2-[(2-fluorophenyl)methyl-methylamino]-2-oxoethyl] (2S,3S)-2-(1,3-dioxoisoindol-2-yl)-3-methylpentanoate |
| SMILES | CC[C@H](C)[C@@H](C(=O)OCC(=O)N(C)Cc1ccccc1F)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C24H25FN2O5/c1-4-15(2)21(27-22(29)17-10-6-7-11-18(17)23(27)30)24(31)32-14-20(28)26(3)13-16-9-5-8-12-19(16)25/h5-12,15,21H,4,13-14H2,1-3H3/t15-,21-/m0/s1 |
| InChIKey | WIFGIIVURUCSNX-BTYIYWSLSA-N |
| XLogP | 3.04 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.47 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|