C36H44N4O8 — CID 7073947
2-[(2R,3R)-1-[10-[(2R,3S)-2-(1,3-dioxoisoindol-2-yl)-3-methylpentanoyl]-1,7-dioxa-4,10-diazacyclododec-4-yl]-3-methyl-1-oxopentan-2-yl]isoindole-1,3-dione (PubChem CID 7073947) has the molecular formula C36H44N4O8 and a molecular weight of 660.77 g/mol. Its IUPAC name is 2-[(2R,3R)-1-[10-[(2R,3S)-2-(1,3-dioxoisoindol-2-yl)-3-methylpentanoyl]-1,7-dioxa-4,10-diazacyclododec-4-yl]-3-methyl-1-oxopentan-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[(2R,3R)-1-[10-[(2R,3S)-2-(1,3-dioxoisoindol-2-yl)-3-methylpentanoyl]-1,7-dioxa-4,10-diazacyclododec-4-yl]-3-methyl-1-oxopentan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 7073947 |
| Molecular Formula | C36H44N4O8 |
| Molecular Weight | 660.77 g/mol |
| Exact Mass | 660.32 |
| IUPAC Name | 2-[(2R,3R)-1-[10-[(2R,3S)-2-(1,3-dioxoisoindol-2-yl)-3-methylpentanoyl]-1,7-dioxa-4,10-diazacyclododec-4-yl]-3-methyl-1-oxopentan-2-yl]isoindole-1,3-dione |
| SMILES | CC[C@@H](C)[C@H](C(=O)N1CCOCCN(C(=O)[C@@H]([C@@H](C)CC)N2C(=O)c3ccccc3C2=O)CCOCC1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C36H44N4O8/c1-5-23(3)29(39-31(41)25-11-7-8-12-26(25)32(39)42)35(45)37-15-19-47-21-17-38(18-22-48-20-16-37)36(46)30(24(4)6-2)40-33(43)27-13-9-10-14-28(27)34(40)44/h7-14,23-24,29-30H,5-6,15-22H2,1-4H3/t23-,24+,29-,30-/m1/s1 |
| InChIKey | TZHWBSASTNQSIK-XSHKJCDBSA-N |
| XLogP | 3.11 |
| TPSA | 133.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.77 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|