C27H29N5O3 — CID 108741219
2-[3-methyl-1-[4-(3-methylquinoxalin-2-yl)piperazin-1-yl]-1-oxopentan-2-yl]isoindole-1,3-dione (PubChem CID 108741219) has the molecular formula C27H29N5O3 and a molecular weight of 471.56 g/mol. Its IUPAC name is 2-[3-methyl-1-[4-(3-methylquinoxalin-2-yl)piperazin-1-yl]-1-oxopentan-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[3-methyl-1-[4-(3-methylquinoxalin-2-yl)piperazin-1-yl]-1-oxopentan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 108741219 |
| Molecular Formula | C27H29N5O3 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | 2-[3-methyl-1-[4-(3-methylquinoxalin-2-yl)piperazin-1-yl]-1-oxopentan-2-yl]isoindole-1,3-dione |
| SMILES | CCC(C)C(C(=O)N1CCN(c2nc3ccccc3nc2C)CC1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C27H29N5O3/c1-4-17(2)23(32-25(33)19-9-5-6-10-20(19)26(32)34)27(35)31-15-13-30(14-16-31)24-18(3)28-21-11-7-8-12-22(21)29-24/h5-12,17,23H,4,13-16H2,1-3H3 |
| InChIKey | HUMYXMDOTHWSFU-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 86.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|