C26H28N4O3S — CID 108756339
2-[1-[4-(6-ethyl-1,3-benzothiazol-2-yl)piperazin-1-yl]-3-methyl-1-oxobutan-2-yl]isoindole-1,3-dione (PubChem CID 108756339) has the molecular formula C26H28N4O3S and a molecular weight of 476.60 g/mol. Its IUPAC name is 2-[1-[4-(6-ethyl-1,3-benzothiazol-2-yl)piperazin-1-yl]-3-methyl-1-oxobutan-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[1-[4-(6-ethyl-1,3-benzothiazol-2-yl)piperazin-1-yl]-3-methyl-1-oxobutan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 108756339 |
| Molecular Formula | C26H28N4O3S |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | 2-[1-[4-(6-ethyl-1,3-benzothiazol-2-yl)piperazin-1-yl]-3-methyl-1-oxobutan-2-yl]isoindole-1,3-dione |
| SMILES | CCc1ccc2nc(N3CCN(C(=O)C(C(C)C)N4C(=O)c5ccccc5C4=O)CC3)sc2c1 |
| InChI | InChI=1S/C26H28N4O3S/c1-4-17-9-10-20-21(15-17)34-26(27-20)29-13-11-28(12-14-29)25(33)22(16(2)3)30-23(31)18-7-5-6-8-19(18)24(30)32/h5-10,15-16,22H,4,11-14H2,1-3H3 |
| InChIKey | LVAPXAQZABJAIX-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|