C28H30N4O3 — CID 108742584
2-[3-methyl-1-[4-(4-methylquinolin-2-yl)piperazin-1-yl]-1-oxopentan-2-yl]isoindole-1,3-dione (PubChem CID 108742584) has the molecular formula C28H30N4O3 and a molecular weight of 470.57 g/mol. Its IUPAC name is 2-[3-methyl-1-[4-(4-methylquinolin-2-yl)piperazin-1-yl]-1-oxopentan-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[3-methyl-1-[4-(4-methylquinolin-2-yl)piperazin-1-yl]-1-oxopentan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 108742584 |
| Molecular Formula | C28H30N4O3 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | 2-[3-methyl-1-[4-(4-methylquinolin-2-yl)piperazin-1-yl]-1-oxopentan-2-yl]isoindole-1,3-dione |
| SMILES | CCC(C)C(C(=O)N1CCN(c2cc(C)c3ccccc3n2)CC1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C28H30N4O3/c1-4-18(2)25(32-26(33)21-10-5-6-11-22(21)27(32)34)28(35)31-15-13-30(14-16-31)24-17-19(3)20-9-7-8-12-23(20)29-24/h5-12,17-18,25H,4,13-16H2,1-3H3 |
| InChIKey | ZRTDOHDGKVJIJG-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|