C24H21BrN4O3 — CID 108742586
5-bromo-2-[2-[4-(4-methylquinolin-2-yl)piperazin-1-yl]-2-oxoethyl]isoindole-1,3-dione (PubChem CID 108742586) has the molecular formula C24H21BrN4O3 and a molecular weight of 493.36 g/mol. Its IUPAC name is 5-bromo-2-[2-[4-(4-methylquinolin-2-yl)piperazin-1-yl]-2-oxoethyl]isoindole-1,3-dione.
| Compound Name | 5-bromo-2-[2-[4-(4-methylquinolin-2-yl)piperazin-1-yl]-2-oxoethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 108742586 |
| Molecular Formula | C24H21BrN4O3 |
| Molecular Weight | 493.36 g/mol |
| Exact Mass | 492.08 |
| IUPAC Name | 5-bromo-2-[2-[4-(4-methylquinolin-2-yl)piperazin-1-yl]-2-oxoethyl]isoindole-1,3-dione |
| SMILES | Cc1cc(N2CCN(C(=O)CN3C(=O)c4ccc(Br)cc4C3=O)CC2)nc2ccccc12 |
| InChI | InChI=1S/C24H21BrN4O3/c1-15-12-21(26-20-5-3-2-4-17(15)20)27-8-10-28(11-9-27)22(30)14-29-23(31)18-7-6-16(25)13-19(18)24(29)32/h2-7,12-13H,8-11,14H2,1H3 |
| InChIKey | SPFPPTQMQAKQHL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.36 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|