C20H17BrFN3O3 — CID 110839302
5-bromo-2-[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl]isoindole-1,3-dione (PubChem CID 110839302) has the molecular formula C20H17BrFN3O3 and a molecular weight of 446.28 g/mol. Its IUPAC name is 5-bromo-2-[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl]isoindole-1,3-dione.
| Compound Name | 5-bromo-2-[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 110839302 |
| Molecular Formula | C20H17BrFN3O3 |
| Molecular Weight | 446.28 g/mol |
| Exact Mass | 445.04 |
| IUPAC Name | 5-bromo-2-[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl]isoindole-1,3-dione |
| SMILES | O=C(CN1C(=O)c2ccc(Br)cc2C1=O)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H17BrFN3O3/c21-13-1-6-16-17(11-13)20(28)25(19(16)27)12-18(26)24-9-7-23(8-10-24)15-4-2-14(22)3-5-15/h1-6,11H,7-10,12H2 |
| InChIKey | QQRAXXYXQABKFU-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.28 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|