C20H24BrN3O4 — CID 32640807
5-bromo-2-[2-[4-(2-ethylbutanoyl)piperazin-1-yl]-2-oxoethyl]isoindole-1,3-dione (PubChem CID 32640807) has the molecular formula C20H24BrN3O4 and a molecular weight of 450.33 g/mol. Its IUPAC name is 5-bromo-2-[2-[4-(2-ethylbutanoyl)piperazin-1-yl]-2-oxoethyl]isoindole-1,3-dione.
| Compound Name | 5-bromo-2-[2-[4-(2-ethylbutanoyl)piperazin-1-yl]-2-oxoethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 32640807 |
| Molecular Formula | C20H24BrN3O4 |
| Molecular Weight | 450.33 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | 5-bromo-2-[2-[4-(2-ethylbutanoyl)piperazin-1-yl]-2-oxoethyl]isoindole-1,3-dione |
| SMILES | CCC(CC)C(=O)N1CCN(C(=O)CN2C(=O)c3ccc(Br)cc3C2=O)CC1 |
| InChI | InChI=1S/C20H24BrN3O4/c1-3-13(4-2)18(26)23-9-7-22(8-10-23)17(25)12-24-19(27)15-6-5-14(21)11-16(15)20(24)28/h5-6,11,13H,3-4,7-10,12H2,1-2H3 |
| InChIKey | HOJZRKMLTBUARX-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.33 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|