C11H12NO5P — CID 11174264
(1,3-dioxoisoindol-2-yl)methyl-ethoxyphosphinic acid (PubChem CID 11174264) has the molecular formula C11H12NO5P and a molecular weight of 269.19 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl)methyl-ethoxyphosphinic acid.
| Compound Name | (1,3-dioxoisoindol-2-yl)methyl-ethoxyphosphinic acid |
|---|---|
| PubChem CID | 11174264 |
| Molecular Formula | C11H12NO5P |
| Molecular Weight | 269.19 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl)methyl-ethoxyphosphinic acid |
| SMILES | CCOP(=O)(O)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C11H12NO5P/c1-2-17-18(15,16)7-12-10(13)8-5-3-4-6-9(8)11(12)14/h3-6H,2,7H2,1H3,(H,15,16) |
| InChIKey | XXTMBFWAXMEOCD-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.19 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|