C15H19INO6P — CID 90364643
2-[4-[ethoxy(iodomethoxy)phosphoryl]-4-hydroxybutyl]isoindole-1,3-dione (PubChem CID 90364643) has the molecular formula C15H19INO6P and a molecular weight of 467.20 g/mol. Its IUPAC name is 2-[4-[ethoxy(iodomethoxy)phosphoryl]-4-hydroxybutyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[ethoxy(iodomethoxy)phosphoryl]-4-hydroxybutyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 90364643 |
| Molecular Formula | C15H19INO6P |
| Molecular Weight | 467.20 g/mol |
| Exact Mass | 467.00 |
| IUPAC Name | 2-[4-[ethoxy(iodomethoxy)phosphoryl]-4-hydroxybutyl]isoindole-1,3-dione |
| SMILES | CCOP(=O)(OCI)C(O)CCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C15H19INO6P/c1-2-22-24(21,23-10-16)13(18)8-5-9-17-14(19)11-6-3-4-7-12(11)15(17)20/h3-4,6-7,13,18H,2,5,8-10H2,1H3 |
| InChIKey | OJFYKCCOTOFCRG-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.20 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|