C22H26NO7P — CID 58658740
2-[3-[3-[diethoxyphosphoryl(hydroxy)methyl]phenoxy]propyl]isoindole-1,3-dione (PubChem CID 58658740) has the molecular formula C22H26NO7P and a molecular weight of 447.42 g/mol. Its IUPAC name is 2-[3-[3-[diethoxyphosphoryl(hydroxy)methyl]phenoxy]propyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[3-[diethoxyphosphoryl(hydroxy)methyl]phenoxy]propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 58658740 |
| Molecular Formula | C22H26NO7P |
| Molecular Weight | 447.42 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | 2-[3-[3-[diethoxyphosphoryl(hydroxy)methyl]phenoxy]propyl]isoindole-1,3-dione |
| SMILES | CCOP(=O)(OCC)C(O)c1cccc(OCCCN2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C22H26NO7P/c1-3-29-31(27,30-4-2)22(26)16-9-7-10-17(15-16)28-14-8-13-23-20(24)18-11-5-6-12-19(18)21(23)25/h5-7,9-12,15,22,26H,3-4,8,13-14H2,1-2H3 |
| InChIKey | QHCMZEZKMSHEMG-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.42 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|