C30H40N2O9P2 — CID 91007931
2-[4-[[2-[2,2-bis(diethoxyphosphoryl)ethyl]-1H-indol-6-yl]oxy]butyl]isoindole-1,3-dione (PubChem CID 91007931) has the molecular formula C30H40N2O9P2 and a molecular weight of 634.60 g/mol. Its IUPAC name is 2-[4-[[2-[2,2-bis(diethoxyphosphoryl)ethyl]-1H-indol-6-yl]oxy]butyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[[2-[2,2-bis(diethoxyphosphoryl)ethyl]-1H-indol-6-yl]oxy]butyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 91007931 |
| Molecular Formula | C30H40N2O9P2 |
| Molecular Weight | 634.60 g/mol |
| Exact Mass | 634.22 |
| IUPAC Name | 2-[4-[[2-[2,2-bis(diethoxyphosphoryl)ethyl]-1H-indol-6-yl]oxy]butyl]isoindole-1,3-dione |
| SMILES | CCOP(=O)(OCC)C(Cc1cc2ccc(OCCCCN3C(=O)c4ccccc4C3=O)cc2[nH]1)P(=O)(OCC)OCC |
| InChI | InChI=1S/C30H40N2O9P2/c1-5-38-42(35,39-6-2)28(43(36,40-7-3)41-8-4)20-23-19-22-15-16-24(21-27(22)31-23)37-18-12-11-17-32-29(33)25-13-9-10-14-26(25)30(32)34/h9-10,13-16,19,21,28,31H,5-8,11-12,17-18,20H2,1-4H3 |
| InChIKey | QCBOWBLWCSGQPK-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 133.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.60 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|