C31H35NO3 — CID 21281160
2-[8-[4-(2,6-dimethylphenyl)-3-methylphenoxy]octyl]isoindole-1,3-dione (PubChem CID 21281160) has the molecular formula C31H35NO3 and a molecular weight of 469.63 g/mol. Its IUPAC name is 2-[8-[4-(2,6-dimethylphenyl)-3-methylphenoxy]octyl]isoindole-1,3-dione.
| Compound Name | 2-[8-[4-(2,6-dimethylphenyl)-3-methylphenoxy]octyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 21281160 |
| Molecular Formula | C31H35NO3 |
| Molecular Weight | 469.63 g/mol |
| Exact Mass | 469.26 |
| IUPAC Name | 2-[8-[4-(2,6-dimethylphenyl)-3-methylphenoxy]octyl]isoindole-1,3-dione |
| SMILES | Cc1cc(OCCCCCCCCN2C(=O)c3ccccc3C2=O)ccc1-c1c(C)cccc1C |
| InChI | InChI=1S/C31H35NO3/c1-22-13-12-14-23(2)29(22)26-18-17-25(21-24(26)3)35-20-11-7-5-4-6-10-19-32-30(33)27-15-8-9-16-28(27)31(32)34/h8-9,12-18,21H,4-7,10-11,19-20H2,1-3H3 |
| InChIKey | DJBJYTJEJNHAHP-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.63 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|