C19H19N2O5+ — CID 91136842
[4-[3-(1,3-dioxoisoindol-2-yl)propoxy]-2-methylphenyl]-methoxy-oxoazanium (PubChem CID 91136842) has the molecular formula C19H19N2O5+ and a molecular weight of 355.37 g/mol. Its IUPAC name is [4-[3-(1,3-dioxoisoindol-2-yl)propoxy]-2-methylphenyl]-methoxy-oxoazanium.
| Compound Name | [4-[3-(1,3-dioxoisoindol-2-yl)propoxy]-2-methylphenyl]-methoxy-oxoazanium |
|---|---|
| PubChem CID | 91136842 |
| Molecular Formula | C19H19N2O5+ |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | [4-[3-(1,3-dioxoisoindol-2-yl)propoxy]-2-methylphenyl]-methoxy-oxoazanium |
| SMILES | CO[N+](=O)c1ccc(OCCCN2C(=O)c3ccccc3C2=O)cc1C |
| InChI | InChI=1S/C19H19N2O5/c1-13-12-14(8-9-17(13)21(24)25-2)26-11-5-10-20-18(22)15-6-3-4-7-16(15)19(20)23/h3-4,6-9,12H,5,10-11H2,1-2H3/q+1 |
| InChIKey | ROIXXEFUHVLSAC-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 75.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|