C20H18ClNO4 — CID 57246381
2-[3-[3-(2-chloropropanoyl)phenoxy]propyl]isoindole-1,3-dione (PubChem CID 57246381) has the molecular formula C20H18ClNO4 and a molecular weight of 371.82 g/mol. Its IUPAC name is 2-[3-[3-(2-chloropropanoyl)phenoxy]propyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[3-(2-chloropropanoyl)phenoxy]propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 57246381 |
| Molecular Formula | C20H18ClNO4 |
| Molecular Weight | 371.82 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 2-[3-[3-(2-chloropropanoyl)phenoxy]propyl]isoindole-1,3-dione |
| SMILES | CC(Cl)C(=O)c1cccc(OCCCN2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C20H18ClNO4/c1-13(21)18(23)14-6-4-7-15(12-14)26-11-5-10-22-19(24)16-8-2-3-9-17(16)20(22)25/h2-4,6-9,12-13H,5,10-11H2,1H3 |
| InChIKey | XJKVIDXNOCFZMC-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.82 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|