C14H16F2NO5P — CID 86606190
2-(2-diethoxyphosphoryl-2,2-difluoroethyl)isoindole-1,3-dione (PubChem CID 86606190) has the molecular formula C14H16F2NO5P and a molecular weight of 347.25 g/mol. Its IUPAC name is 2-(2-diethoxyphosphoryl-2,2-difluoroethyl)isoindole-1,3-dione.
| Compound Name | 2-(2-diethoxyphosphoryl-2,2-difluoroethyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 86606190 |
| Molecular Formula | C14H16F2NO5P |
| Molecular Weight | 347.25 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | 2-(2-diethoxyphosphoryl-2,2-difluoroethyl)isoindole-1,3-dione |
| SMILES | CCOP(=O)(OCC)C(F)(F)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C14H16F2NO5P/c1-3-21-23(20,22-4-2)14(15,16)9-17-12(18)10-7-5-6-8-11(10)13(17)19/h5-8H,3-4,9H2,1-2H3 |
| InChIKey | AGJUSXOWTFWIMY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.25 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|