C14H16F6N2O2 — CID 164901575
ethane;2,2,2-trifluoroethanamine;2-(2,2,2-trifluoroethyl)isoindole-1,3-dione (PubChem CID 164901575) has the molecular formula C14H16F6N2O2 and a molecular weight of 358.28 g/mol. Its IUPAC name is ethane;2,2,2-trifluoroethanamine;2-(2,2,2-trifluoroethyl)isoindole-1,3-dione.
| Compound Name | ethane;2,2,2-trifluoroethanamine;2-(2,2,2-trifluoroethyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 164901575 |
| Molecular Formula | C14H16F6N2O2 |
| Molecular Weight | 358.28 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | ethane;2,2,2-trifluoroethanamine;2-(2,2,2-trifluoroethyl)isoindole-1,3-dione |
| SMILES | CC.NCC(F)(F)F.O=C1c2ccccc2C(=O)N1CC(F)(F)F |
| InChI | InChI=1S/C10H6F3NO2.C2H4F3N.C2H6/c11-10(12,13)5-14-8(15)6-3-1-2-4-7(6)9(14)16;3-2(4,5)1-6;1-2/h1-4H,5H2;1,6H2;1-2H3 |
| InChIKey | ZFLRKKHSLRZSBP-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.28 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|