C18H11F6NO2 — CID 87759453
2-[3,3,3-trifluoro-2-phenyl-2-(trifluoromethyl)propyl]isoindole-1,3-dione (PubChem CID 87759453) has the molecular formula C18H11F6NO2 and a molecular weight of 387.28 g/mol. Its IUPAC name is 2-[3,3,3-trifluoro-2-phenyl-2-(trifluoromethyl)propyl]isoindole-1,3-dione.
| Compound Name | 2-[3,3,3-trifluoro-2-phenyl-2-(trifluoromethyl)propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 87759453 |
| Molecular Formula | C18H11F6NO2 |
| Molecular Weight | 387.28 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | 2-[3,3,3-trifluoro-2-phenyl-2-(trifluoromethyl)propyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CC(c1ccccc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C18H11F6NO2/c19-17(20,21)16(18(22,23)24,11-6-2-1-3-7-11)10-25-14(26)12-8-4-5-9-13(12)15(25)27/h1-9H,10H2 |
| InChIKey | CGDDYPZNCJERSX-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.28 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|