C24H28N2O4 — CID 69020716
[3-[(1,3-dioxoisoindol-2-yl)methyl]-2,2,4-trimethyl-4-phenylpentan-3-yl]carbamic acid (PubChem CID 69020716) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is [3-[(1,3-dioxoisoindol-2-yl)methyl]-2,2,4-trimethyl-4-phenylpentan-3-yl]carbamic acid.
| Compound Name | [3-[(1,3-dioxoisoindol-2-yl)methyl]-2,2,4-trimethyl-4-phenylpentan-3-yl]carbamic acid |
|---|---|
| PubChem CID | 69020716 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | [3-[(1,3-dioxoisoindol-2-yl)methyl]-2,2,4-trimethyl-4-phenylpentan-3-yl]carbamic acid |
| SMILES | CC(C)(C)C(CN1C(=O)c2ccccc2C1=O)(NC(=O)O)C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C24H28N2O4/c1-22(2,3)24(25-21(29)30,23(4,5)16-11-7-6-8-12-16)15-26-19(27)17-13-9-10-14-18(17)20(26)28/h6-14,25H,15H2,1-5H3,(H,29,30) |
| InChIKey | KMLLCPCFQBVNIP-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|