C17H13NO4 — CID 102370956
(2R)-2-(1,3-dioxoisoindol-2-yl)-2-phenylpropanoic acid (PubChem CID 102370956) has the molecular formula C17H13NO4 and a molecular weight of 295.29 g/mol. Its IUPAC name is (2R)-2-(1,3-dioxoisoindol-2-yl)-2-phenylpropanoic acid.
| Compound Name | (2R)-2-(1,3-dioxoisoindol-2-yl)-2-phenylpropanoic acid |
|---|---|
| PubChem CID | 102370956 |
| Molecular Formula | C17H13NO4 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | (2R)-2-(1,3-dioxoisoindol-2-yl)-2-phenylpropanoic acid |
| SMILES | C[C@](C(=O)O)(c1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H13NO4/c1-17(16(21)22,11-7-3-2-4-8-11)18-14(19)12-9-5-6-10-13(12)15(18)20/h2-10H,1H3,(H,21,22)/t17-/m1/s1 |
| InChIKey | OSSSMIUWHFOPJW-QGZVFWFLSA-N |
| XLogP | 2.28 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|