C18H15NO4 — CID 58721880
2-[3-(1,3-dioxoisoindol-2-yl)phenyl]-2-methylpropanoic acid (PubChem CID 58721880) has the molecular formula C18H15NO4 and a molecular weight of 309.32 g/mol. Its IUPAC name is 2-[3-(1,3-dioxoisoindol-2-yl)phenyl]-2-methylpropanoic acid.
| Compound Name | 2-[3-(1,3-dioxoisoindol-2-yl)phenyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 58721880 |
| Molecular Formula | C18H15NO4 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 2-[3-(1,3-dioxoisoindol-2-yl)phenyl]-2-methylpropanoic acid |
| SMILES | CC(C)(C(=O)O)c1cccc(N2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C18H15NO4/c1-18(2,17(22)23)11-6-5-7-12(10-11)19-15(20)13-8-3-4-9-14(13)16(19)21/h3-10H,1-2H3,(H,22,23) |
| InChIKey | IOIJYFMNPRKDKG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|