C16H10F3NO — CID 14662954
3-methylidene-2-[3-(trifluoromethyl)phenyl]isoindol-1-one (PubChem CID 14662954) has the molecular formula C16H10F3NO and a molecular weight of 289.26 g/mol. Its IUPAC name is 3-methylidene-2-[3-(trifluoromethyl)phenyl]isoindol-1-one.
| Compound Name | 3-methylidene-2-[3-(trifluoromethyl)phenyl]isoindol-1-one |
|---|---|
| PubChem CID | 14662954 |
| Molecular Formula | C16H10F3NO |
| Molecular Weight | 289.26 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 3-methylidene-2-[3-(trifluoromethyl)phenyl]isoindol-1-one |
| SMILES | C=C1c2ccccc2C(=O)N1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H10F3NO/c1-10-13-7-2-3-8-14(13)15(21)20(10)12-6-4-5-11(9-12)16(17,18)19/h2-9H,1H2 |
| InChIKey | FPDJXJIBNVETNX-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.26 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |