C47H50N2O6 — CID 157087503
2-tert-butylisoindole-1,3-dione;2-(3-tert-butylphenyl)isoindole-1,3-dione;1-methoxy-4-[2-(4-methoxyphenyl)propan-2-yl]benzene (PubChem CID 157087503) has the molecular formula C47H50N2O6 and a molecular weight of 738.93 g/mol. Its IUPAC name is 2-tert-butylisoindole-1,3-dione;2-(3-tert-butylphenyl)isoindole-1,3-dione;1-methoxy-4-[2-(4-methoxyphenyl)propan-2-yl]benzene.
| Compound Name | 2-tert-butylisoindole-1,3-dione;2-(3-tert-butylphenyl)isoindole-1,3-dione;1-methoxy-4-[2-(4-methoxyphenyl)propan-2-yl]benzene |
|---|---|
| PubChem CID | 157087503 |
| Molecular Formula | C47H50N2O6 |
| Molecular Weight | 738.93 g/mol |
| Exact Mass | 738.37 |
| IUPAC Name | 2-tert-butylisoindole-1,3-dione;2-(3-tert-butylphenyl)isoindole-1,3-dione;1-methoxy-4-[2-(4-methoxyphenyl)propan-2-yl]benzene |
| SMILES | CC(C)(C)N1C(=O)c2ccccc2C1=O.CC(C)(C)c1cccc(N2C(=O)c3ccccc3C2=O)c1.COc1ccc(C(C)(C)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C18H17NO2.C17H20O2.C12H13NO2/c1-18(2,3)12-7-6-8-13(11-12)19-16(20)14-9-4-5-10-15(14)17(19)21;1-17(2,13-5-9-15(18-3)10-6-13)14-7-11-16(19-4)12-8-14;1-12(2,3)13-10(14)8-6-4-5-7-9(8)11(13)15/h4-11H,1-3H3;5-12H,1-4H3;4-7H,1-3H3 |
| InChIKey | AEGMOJPVKWZXTO-UHFFFAOYSA-N |
| XLogP | 9.90 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.93 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|