C22H17NO5 — CID 66624353
(2S)-2-(1,3-dioxoisoindol-2-yl)-2-(6-methoxynaphthalen-2-yl)propanoic acid (PubChem CID 66624353) has the molecular formula C22H17NO5 and a molecular weight of 375.38 g/mol. Its IUPAC name is (2S)-2-(1,3-dioxoisoindol-2-yl)-2-(6-methoxynaphthalen-2-yl)propanoic acid.
| Compound Name | (2S)-2-(1,3-dioxoisoindol-2-yl)-2-(6-methoxynaphthalen-2-yl)propanoic acid |
|---|---|
| PubChem CID | 66624353 |
| Molecular Formula | C22H17NO5 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | (2S)-2-(1,3-dioxoisoindol-2-yl)-2-(6-methoxynaphthalen-2-yl)propanoic acid |
| SMILES | COc1ccc2cc([C@@](C)(C(=O)O)N3C(=O)c4ccccc4C3=O)ccc2c1 |
| InChI | InChI=1S/C22H17NO5/c1-22(21(26)27,23-19(24)17-5-3-4-6-18(17)20(23)25)15-9-7-14-12-16(28-2)10-8-13(14)11-15/h3-12H,1-2H3,(H,26,27)/t22-/m0/s1 |
| InChIKey | BQHINIWNFPTQNA-QFIPXVFZSA-N |
| XLogP | 3.44 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|