C18H16N2O5 — CID 57300621
2-(1,3-dioxoisoindol-2-yl)-2-methoxy-2-(4-methoxyphenyl)acetamide (PubChem CID 57300621) has the molecular formula C18H16N2O5 and a molecular weight of 340.34 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-2-methoxy-2-(4-methoxyphenyl)acetamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-2-methoxy-2-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 57300621 |
| Molecular Formula | C18H16N2O5 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-2-methoxy-2-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(C(OC)(C(N)=O)N2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C18H16N2O5/c1-24-12-9-7-11(8-10-12)18(25-2,17(19)23)20-15(21)13-5-3-4-6-14(13)16(20)22/h3-10H,1-2H3,(H2,19,23) |
| InChIKey | SKKJRXCQXQIPNP-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|