C12H15F3N2O2 — CID 54892605
2-(4-methoxyphenyl)-2-(2,2,2-trifluoroethylamino)propanamide (PubChem CID 54892605) has the molecular formula C12H15F3N2O2 and a molecular weight of 276.26 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-2-(2,2,2-trifluoroethylamino)propanamide.
| Compound Name | 2-(4-methoxyphenyl)-2-(2,2,2-trifluoroethylamino)propanamide |
|---|---|
| PubChem CID | 54892605 |
| Molecular Formula | C12H15F3N2O2 |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 2-(4-methoxyphenyl)-2-(2,2,2-trifluoroethylamino)propanamide |
| SMILES | COc1ccc(C(C)(NCC(F)(F)F)C(N)=O)cc1 |
| InChI | InChI=1S/C12H15F3N2O2/c1-11(10(16)18,17-7-12(13,14)15)8-3-5-9(19-2)6-4-8/h3-6,17H,7H2,1-2H3,(H2,16,18) |
| InChIKey | XCPMBRDDFMSORV-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |