C14H18F3NO3 — CID 60998457
2-(4-propoxyphenyl)-2-(2,2,2-trifluoroethylamino)propanoic acid (PubChem CID 60998457) has the molecular formula C14H18F3NO3 and a molecular weight of 305.30 g/mol. Its IUPAC name is 2-(4-propoxyphenyl)-2-(2,2,2-trifluoroethylamino)propanoic acid.
| Compound Name | 2-(4-propoxyphenyl)-2-(2,2,2-trifluoroethylamino)propanoic acid |
|---|---|
| PubChem CID | 60998457 |
| Molecular Formula | C14H18F3NO3 |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 2-(4-propoxyphenyl)-2-(2,2,2-trifluoroethylamino)propanoic acid |
| SMILES | CCCOc1ccc(C(C)(NCC(F)(F)F)C(=O)O)cc1 |
| InChI | InChI=1S/C14H18F3NO3/c1-3-8-21-11-6-4-10(5-7-11)13(2,12(19)20)18-9-14(15,16)17/h4-7,18H,3,8-9H2,1-2H3,(H,19,20) |
| InChIKey | JRJPWTXJECZRBL-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |