C11H12F4N2O — CID 54892842
2-(3-fluorophenyl)-2-(2,2,2-trifluoroethylamino)propanamide (PubChem CID 54892842) has the molecular formula C11H12F4N2O and a molecular weight of 264.22 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-2-(2,2,2-trifluoroethylamino)propanamide.
| Compound Name | 2-(3-fluorophenyl)-2-(2,2,2-trifluoroethylamino)propanamide |
|---|---|
| PubChem CID | 54892842 |
| Molecular Formula | C11H12F4N2O |
| Molecular Weight | 264.22 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 2-(3-fluorophenyl)-2-(2,2,2-trifluoroethylamino)propanamide |
| SMILES | CC(NCC(F)(F)F)(C(N)=O)c1cccc(F)c1 |
| InChI | InChI=1S/C11H12F4N2O/c1-10(9(16)18,17-6-11(13,14)15)7-3-2-4-8(12)5-7/h2-5,17H,6H2,1H3,(H2,16,18) |
| InChIKey | PSWVZEPLNIIVHE-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.22 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |