C17H18BrNO4 — CID 89368240
methyl (E)-2-bromo-6-(1,3-dioxoisoindol-2-yl)-5,5-dimethylhex-2-enoate (PubChem CID 89368240) has the molecular formula C17H18BrNO4 and a molecular weight of 380.24 g/mol. Its IUPAC name is methyl (E)-2-bromo-6-(1,3-dioxoisoindol-2-yl)-5,5-dimethylhex-2-enoate.
| Compound Name | methyl (E)-2-bromo-6-(1,3-dioxoisoindol-2-yl)-5,5-dimethylhex-2-enoate |
|---|---|
| PubChem CID | 89368240 |
| Molecular Formula | C17H18BrNO4 |
| Molecular Weight | 380.24 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | methyl (E)-2-bromo-6-(1,3-dioxoisoindol-2-yl)-5,5-dimethylhex-2-enoate |
| SMILES | COC(=O)/C(Br)=C\CC(C)(C)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H18BrNO4/c1-17(2,9-8-13(18)16(22)23-3)10-19-14(20)11-6-4-5-7-12(11)15(19)21/h4-8H,9-10H2,1-3H3/b13-8+ |
| InChIKey | IMCFFFYSUKAQAI-MDWZMJQESA-N |
| XLogP | 3.15 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.24 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|