C16H14N2O7 — CID 177388109
dimethyl (E)-2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]but-2-enedioate (PubChem CID 177388109) has the molecular formula C16H14N2O7 and a molecular weight of 346.30 g/mol. Its IUPAC name is dimethyl (E)-2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]but-2-enedioate |
|---|---|
| PubChem CID | 177388109 |
| Molecular Formula | C16H14N2O7 |
| Molecular Weight | 346.30 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | dimethyl (E)-2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/NC(=O)CN1C(=O)c2ccccc2C1=O)C(=O)OC |
| InChI | InChI=1S/C16H14N2O7/c1-24-13(20)7-11(16(23)25-2)17-12(19)8-18-14(21)9-5-3-4-6-10(9)15(18)22/h3-7H,8H2,1-2H3,(H,17,19)/b11-7+ |
| InChIKey | HHIQHVSPHHXTFM-YRNVUSSQSA-N |
| XLogP | -0.37 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.30 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|