C16H14N2O8 — CID 168566260
2-[4-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]-1,3-dioxoisoindol-2-yl]acetic acid (PubChem CID 168566260) has the molecular formula C16H14N2O8 and a molecular weight of 362.29 g/mol. Its IUPAC name is 2-[4-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]-1,3-dioxoisoindol-2-yl]acetic acid.
| Compound Name | 2-[4-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]-1,3-dioxoisoindol-2-yl]acetic acid |
|---|---|
| PubChem CID | 168566260 |
| Molecular Formula | C16H14N2O8 |
| Molecular Weight | 362.29 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | 2-[4-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]-1,3-dioxoisoindol-2-yl]acetic acid |
| SMILES | COC(=O)/C=C(/Nc1cccc2c1C(=O)N(CC(=O)O)C2=O)C(=O)OC |
| InChI | InChI=1S/C16H14N2O8/c1-25-12(21)6-10(16(24)26-2)17-9-5-3-4-8-13(9)15(23)18(14(8)22)7-11(19)20/h3-6,17H,7H2,1-2H3,(H,19,20)/b10-6+ |
| InChIKey | ANRGGINFNPVTDC-UXBLZVDNSA-N |
| XLogP | 0.01 |
| TPSA | 139.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.29 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|