C16H17NO5 — CID 168569548
dimethyl (E)-2-[(8-oxo-6,7-dihydro-5H-naphthalen-1-yl)amino]but-2-enedioate (PubChem CID 168569548) has the molecular formula C16H17NO5 and a molecular weight of 303.31 g/mol. Its IUPAC name is dimethyl (E)-2-[(8-oxo-6,7-dihydro-5H-naphthalen-1-yl)amino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[(8-oxo-6,7-dihydro-5H-naphthalen-1-yl)amino]but-2-enedioate |
|---|---|
| PubChem CID | 168569548 |
| Molecular Formula | C16H17NO5 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | dimethyl (E)-2-[(8-oxo-6,7-dihydro-5H-naphthalen-1-yl)amino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1cccc2c1C(=O)CCC2)C(=O)OC |
| InChI | InChI=1S/C16H17NO5/c1-21-14(19)9-12(16(20)22-2)17-11-7-3-5-10-6-4-8-13(18)15(10)11/h3,5,7,9,17H,4,6,8H2,1-2H3/b12-9+ |
| InChIKey | QFDWBSNWKCPNHA-FMIVXFBMSA-N |
| XLogP | 1.85 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|