C15H14N2O5 — CID 168569854
dimethyl (E)-2-[(3-oxo-2H-isoquinolin-5-yl)amino]but-2-enedioate (PubChem CID 168569854) has the molecular formula C15H14N2O5 and a molecular weight of 302.29 g/mol. Its IUPAC name is dimethyl (E)-2-[(3-oxo-2H-isoquinolin-5-yl)amino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[(3-oxo-2H-isoquinolin-5-yl)amino]but-2-enedioate |
|---|---|
| PubChem CID | 168569854 |
| Molecular Formula | C15H14N2O5 |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | dimethyl (E)-2-[(3-oxo-2H-isoquinolin-5-yl)amino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1cccc2c[nH]c(=O)cc12)C(=O)OC |
| InChI | InChI=1S/C15H14N2O5/c1-21-14(19)7-12(15(20)22-2)17-11-5-3-4-9-8-16-13(18)6-10(9)11/h3-8,17H,1-2H3,(H,16,18)/b12-7+ |
| InChIKey | HYOSBCGHZYUSIW-KPKJPENVSA-N |
| XLogP | 1.17 |
| TPSA | 97.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|